C19H24N2O — CID 175944254
1,5-bis[4-(methylamino)phenyl]pentan-3-one (PubChem CID 175944254) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 1,5-bis[4-(methylamino)phenyl]pentan-3-one.
| Compound Name | 1,5-bis[4-(methylamino)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 175944254 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1,5-bis[4-(methylamino)phenyl]pentan-3-one |
| SMILES | CNc1ccc(CCC(=O)CCc2ccc(NC)cc2)cc1 |
| InChI | InChI=1S/C19H24N2O/c1-20-17-9-3-15(4-10-17)7-13-19(22)14-8-16-5-11-18(21-2)12-6-16/h3-6,9-12,20-21H,7-8,13-14H2,1-2H3 |
| InChIKey | SDZKEGDRCKUWFB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |