C17H16N4OS — CID 175944576
[4-[(4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-9-yl)methyl]phenyl]methanol (PubChem CID 175944576) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is [4-[(4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-9-yl)methyl]phenyl]methanol.
| Compound Name | [4-[(4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-9-yl)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 175944576 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | [4-[(4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-9-yl)methyl]phenyl]methanol |
| SMILES | Cc1nc2c(s1)c1cnnc(Cc3ccc(CO)cc3)c1n2C |
| InChI | InChI=1S/C17H16N4OS/c1-10-19-17-16(23-10)13-8-18-20-14(15(13)21(17)2)7-11-3-5-12(9-22)6-4-11/h3-6,8,22H,7,9H2,1-2H3 |
| InChIKey | XDOPLEOTLVKGIK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |