C17H15ClN2O2 — CID 175945117
(3S)-3-amino-4-[3-(4-chloro-3-cyanophenyl)phenyl]butanoic acid (PubChem CID 175945117) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is (3S)-3-amino-4-[3-(4-chloro-3-cyanophenyl)phenyl]butanoic acid.
| Compound Name | (3S)-3-amino-4-[3-(4-chloro-3-cyanophenyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 175945117 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (3S)-3-amino-4-[3-(4-chloro-3-cyanophenyl)phenyl]butanoic acid |
| SMILES | N#Cc1cc(-c2cccc(C[C@H](N)CC(=O)O)c2)ccc1Cl |
| InChI | InChI=1S/C17H15ClN2O2/c18-16-5-4-13(8-14(16)10-19)12-3-1-2-11(6-12)7-15(20)9-17(21)22/h1-6,8,15H,7,9,20H2,(H,21,22)/t15-/m0/s1 |
| InChIKey | LRDXHYQLUCBGEN-HNNXBMFYSA-N |
| XLogP | 3.22 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |