C25H33N5O2S — CID 175945644
5-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[(4-methoxyphenyl)methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,10-tetraen-7-amine (PubChem CID 175945644) has the molecular formula C25H33N5O2S and a molecular weight of 467.64 g/mol. Its IUPAC name is 5-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[(4-methoxyphenyl)methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,10-tetraen-7-amine.
| Compound Name | 5-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[(4-methoxyphenyl)methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,10-tetraen-7-amine |
|---|---|
| PubChem CID | 175945644 |
| Molecular Formula | C25H33N5O2S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 5-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[(4-methoxyphenyl)methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,10-tetraen-7-amine |
| SMILES | COc1ccc(CN2CN(CCCN3CC(C)OC(C)C3)c3c(N)nc4ccsc4c32)cc1 |
| InChI | InChI=1S/C25H33N5O2S/c1-17-13-28(14-18(2)32-17)10-4-11-29-16-30(15-19-5-7-20(31-3)8-6-19)22-23(29)25(26)27-21-9-12-33-24(21)22/h5-9,12,17-18H,4,10-11,13-16H2,1-3H3,(H2,26,27) |
| InChIKey | CHYHGLMDNHPMQH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |