C10H16N2O4 — CID 175945779
N,2,2,3a-tetramethyl-4-oxo-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide (PubChem CID 175945779) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is N,2,2,3a-tetramethyl-4-oxo-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide.
| Compound Name | N,2,2,3a-tetramethyl-4-oxo-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 175945779 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N,2,2,3a-tetramethyl-4-oxo-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
| SMILES | CNC(=O)C1NC(=O)C2(C)OC(C)(C)OC12 |
| InChI | InChI=1S/C10H16N2O4/c1-9(2)15-6-5(7(13)11-4)12-8(14)10(6,3)16-9/h5-6H,1-4H3,(H,11,13)(H,12,14) |
| InChIKey | MMNARQKYXYGFJI-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |