About N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide
N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 175946234) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide |
| PubChem CID | 175946234 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H]1n1cccc(NC(=O)c2ccccn2)c1=O |
| InChI | InChI=1S/C15H15N3O2/c1-10-9-13(10)18-8-4-6-12(15(18)20)17-14(19)11-5-2-3-7-16-11/h2-8,10,13H,9H2,1H3,(H,17,19)/t10-,13-/m0/s1 |
| InChIKey | CGENCDGQVIWDKA-GWCFXTLKSA-N |
| XLogP | 2.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide?
The IUPAC name of N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide (CID 175946234) is N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide.
What is the SMILES notation for N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide?
The canonical SMILES for N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide is C[C@H]1C[C@@H]1n1cccc(NC(=O)c2ccccn2)c1=O.
What is the InChIKey of N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide?
The InChIKey is CGENCDGQVIWDKA-GWCFXTLKSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-10-9-13(10)18-8-4-6-12(15(18)20)17-14(19)11-5-2-3-7-16-11/h2-8,10,13H,9H2,1H3,(H,17,19)/t10-,13-/m0/s1.
What are the key properties of N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide?
N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide has a molecular weight of 269.30 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(1S,2S)-2-methylcyclopropyl]-2-oxo-3-pyridinyl]pyridine-2-carboxamide is sourced from PubChem (CID 175946234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).