About 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile
2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile (PubChem CID 175946446) has the molecular formula C15H8ClN3O
and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile |
| PubChem CID | 175946446 |
| Molecular Formula | C15H8ClN3O |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile |
| SMILES | N#Cc1cncc2nc(Oc3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C15H8ClN3O/c16-11-1-3-12(4-2-11)20-15-6-5-13-10(7-17)8-18-9-14(13)19-15/h1-6,8-9H |
| InChIKey | IMYFDKYABQQRJQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile?
The IUPAC name of 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile (CID 175946446) is 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile.
What is the SMILES notation for 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile?
The canonical SMILES for 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile is N#Cc1cncc2nc(Oc3ccc(Cl)cc3)ccc12.
What is the InChIKey of 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile?
The InChIKey is IMYFDKYABQQRJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8ClN3O/c16-11-1-3-12(4-2-11)20-15-6-5-13-10(7-17)8-18-9-14(13)19-15/h1-6,8-9H.
What are the key properties of 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile?
2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile has a molecular weight of 281.70 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenoxy)-1,7-naphthyridine-5-carbonitrile is sourced from PubChem (CID 175946446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).