About 3-ethyliminopropyl acetate
3-ethyliminopropyl acetate (PubChem CID 175947325) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-ethyliminopropyl acetate.
Molecular Properties
| Compound Name | 3-ethyliminopropyl acetate |
| PubChem CID | 175947325 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3-ethyliminopropyl acetate |
| SMILES | CC/N=C/CCOC(C)=O |
| InChI | InChI=1S/C7H13NO2/c1-3-8-5-4-6-10-7(2)9/h5H,3-4,6H2,1-2H3/b8-5+ |
| InChIKey | FIJAVWNTWYNYDR-VMPITWQZSA-N |
| XLogP | 1.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyliminopropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyliminopropyl acetate?
The IUPAC name of 3-ethyliminopropyl acetate (CID 175947325) is 3-ethyliminopropyl acetate.
What is the SMILES notation for 3-ethyliminopropyl acetate?
The canonical SMILES for 3-ethyliminopropyl acetate is CC/N=C/CCOC(C)=O.
What is the InChIKey of 3-ethyliminopropyl acetate?
The InChIKey is FIJAVWNTWYNYDR-VMPITWQZSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-8-5-4-6-10-7(2)9/h5H,3-4,6H2,1-2H3/b8-5+.
What are the key properties of 3-ethyliminopropyl acetate?
3-ethyliminopropyl acetate has a molecular weight of 143.19 g/mol, XLogP of 1.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyliminopropyl acetate is sourced from PubChem (CID 175947325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).