C13H16ClN3O2 — CID 175947839
1-[4-[6-chloro-4-(trideuteriomethoxy)-3-pyridinyl]pyrazol-1-yl]-2-methylpropan-2-ol (PubChem CID 175947839) has the molecular formula C13H16ClN3O2 and a molecular weight of 284.76 g/mol. Its IUPAC name is 1-[4-[6-chloro-4-(trideuteriomethoxy)-3-pyridinyl]pyrazol-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-[6-chloro-4-(trideuteriomethoxy)-3-pyridinyl]pyrazol-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 175947839 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[4-[6-chloro-4-(trideuteriomethoxy)-3-pyridinyl]pyrazol-1-yl]-2-methylpropan-2-ol |
| SMILES | [2H]C([2H])([2H])Oc1cc(Cl)ncc1-c1cnn(CC(C)(C)O)c1 |
| InChI | InChI=1S/C13H16ClN3O2/c1-13(2,18)8-17-7-9(5-16-17)10-6-15-12(14)4-11(10)19-3/h4-7,18H,8H2,1-3H3/i3D3 |
| InChIKey | YRPSDHLLIIJLMY-HPRDVNIFSA-N |
| XLogP | 2.38 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|