C26H27ClN4 — CID 175947897
6-chloro-9-[(2E,6E)-2,6-dimethyl-8-(3-methylnaphthalen-2-yl)octa-2,6-dienyl]purine (PubChem CID 175947897) has the molecular formula C26H27ClN4 and a molecular weight of 430.98 g/mol. Its IUPAC name is 6-chloro-9-[(2E,6E)-2,6-dimethyl-8-(3-methylnaphthalen-2-yl)octa-2,6-dienyl]purine.
| Compound Name | 6-chloro-9-[(2E,6E)-2,6-dimethyl-8-(3-methylnaphthalen-2-yl)octa-2,6-dienyl]purine |
|---|---|
| PubChem CID | 175947897 |
| Molecular Formula | C26H27ClN4 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 6-chloro-9-[(2E,6E)-2,6-dimethyl-8-(3-methylnaphthalen-2-yl)octa-2,6-dienyl]purine |
| SMILES | C/C(=C\Cc1cc2ccccc2cc1C)CC/C=C(\C)Cn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C26H27ClN4/c1-18(11-12-21-14-23-10-5-4-9-22(23)13-20(21)3)7-6-8-19(2)15-31-17-30-24-25(27)28-16-29-26(24)31/h4-5,8-11,13-14,16-17H,6-7,12,15H2,1-3H3/b18-11+,19-8+ |
| InChIKey | JBHJOFZSYYRLOE-YBAQAESASA-N |
| XLogP | 6.86 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|