C30H41FN2O7S — CID 175948794
[(1R,2E,4S,5S,9R,12S)-5-[(E)-1-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]prop-1-en-2-yl]-9-hydroxy-4,12-dimethyl-6,7-dioxocyclododec-2-en-1-yl] N,N-dimethylcarbamate (PubChem CID 175948794) has the molecular formula C30H41FN2O7S and a molecular weight of 592.73 g/mol. Its IUPAC name is [(1R,2E,4S,5S,9R,12S)-5-[(E)-1-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]prop-1-en-2-yl]-9-hydroxy-4,12-dimethyl-6,7-dioxocyclododec-2-en-1-yl] N,N-dimethylcarbamate.
| Compound Name | [(1R,2E,4S,5S,9R,12S)-5-[(E)-1-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]prop-1-en-2-yl]-9-hydroxy-4,12-dimethyl-6,7-dioxocyclododec-2-en-1-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 175948794 |
| Molecular Formula | C30H41FN2O7S |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | [(1R,2E,4S,5S,9R,12S)-5-[(E)-1-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]prop-1-en-2-yl]-9-hydroxy-4,12-dimethyl-6,7-dioxocyclododec-2-en-1-yl] N,N-dimethylcarbamate |
| SMILES | C/C(=C\c1cc(F)cc(N2CCS(=O)(=O)CC2)c1)[C@H]1C(=O)C(=O)C[C@H](O)CC[C@H](C)[C@@H](OC(=O)N(C)C)/C=C/[C@@H]1C |
| InChI | InChI=1S/C30H41FN2O7S/c1-19-6-8-25(34)18-26(35)29(36)28(20(2)7-9-27(19)40-30(37)32(4)5)21(3)14-22-15-23(31)17-24(16-22)33-10-12-41(38,39)13-11-33/h7,9,14-17,19-20,25,27-28,34H,6,8,10-13,18H2,1-5H3/b9-7+,21-14+/t19-,20-,25+,27-,28-/m0/s1 |
| InChIKey | XGJYSZAOQISJRP-WJFVLJATSA-N |
| XLogP | 3.66 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|