C24H27FO4 — CID 175950921
4-[(2S,3R,4R)-2-(4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]oxolan-3-yl]-2,3-dimethylbut-2-enoic acid (PubChem CID 175950921) has the molecular formula C24H27FO4 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[(2S,3R,4R)-2-(4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]oxolan-3-yl]-2,3-dimethylbut-2-enoic acid.
| Compound Name | 4-[(2S,3R,4R)-2-(4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]oxolan-3-yl]-2,3-dimethylbut-2-enoic acid |
|---|---|
| PubChem CID | 175950921 |
| Molecular Formula | C24H27FO4 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[(2S,3R,4R)-2-(4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]oxolan-3-yl]-2,3-dimethylbut-2-enoic acid |
| SMILES | COc1ccc(C[C@H]2CO[C@H](c3ccc(F)cc3)[C@@H]2CC(C)=C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C24H27FO4/c1-15(16(2)24(26)27)12-22-19(13-17-4-10-21(28-3)11-5-17)14-29-23(22)18-6-8-20(25)9-7-18/h4-11,19,22-23H,12-14H2,1-3H3,(H,26,27)/t19-,22+,23+/m0/s1 |
| InChIKey | ISXZLLMYQODVTM-WWPVKYPJSA-N |
| XLogP | 5.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|