About 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide
2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide (PubChem CID 175951982) has the molecular formula C13H21N5O2S
and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide |
| PubChem CID | 175951982 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CCN(CC(N)=O)CC2C)s1 |
| InChI | InChI=1S/C13H21N5O2S/c1-9-6-17(8-12(14)20)3-4-18(9)7-11-5-15-13(21-11)16-10(2)19/h5,9H,3-4,6-8H2,1-2H3,(H2,14,20)(H,15,16,19) |
| InChIKey | QYFHSYDWBDGARG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide?
The IUPAC name of 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide (CID 175951982) is 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide.
What is the SMILES notation for 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide?
The canonical SMILES for 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide is CC(=O)Nc1ncc(CN2CCN(CC(N)=O)CC2C)s1.
What is the InChIKey of 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide?
The InChIKey is QYFHSYDWBDGARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O2S/c1-9-6-17(8-12(14)20)3-4-18(9)7-11-5-15-13(21-11)16-10(2)19/h5,9H,3-4,6-8H2,1-2H3,(H2,14,20)(H,15,16,19).
What are the key properties of 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide?
2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide has a molecular weight of 311.41 g/mol, XLogP of 0.09, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]acetamide is sourced from PubChem (CID 175951982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).