About [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid
[2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid (PubChem CID 175952229) has the molecular formula C11H22BF3N2O4
and a molecular weight of 314.11 g/mol. Its IUPAC name is [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid.
Molecular Properties
| Compound Name | [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid |
| PubChem CID | 175952229 |
| Molecular Formula | C11H22BF3N2O4 |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid |
| SMILES | COCC1(F)N(CC(C)C)CCN(COB(O)O)C1(F)F |
| InChI | InChI=1S/C11H22BF3N2O4/c1-9(2)6-16-4-5-17(8-21-12(18)19)11(14,15)10(16,13)7-20-3/h9,18-19H,4-8H2,1-3H3 |
| InChIKey | HIYXGVAUVUALMN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid?
The IUPAC name of [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid (CID 175952229) is [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid.
What is the SMILES notation for [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid?
The canonical SMILES for [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid is COCC1(F)N(CC(C)C)CCN(COB(O)O)C1(F)F.
What is the InChIKey of [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid?
The InChIKey is HIYXGVAUVUALMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22BF3N2O4/c1-9(2)6-16-4-5-17(8-21-12(18)19)11(14,15)10(16,13)7-20-3/h9,18-19H,4-8H2,1-3H3.
What are the key properties of [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid?
[2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid has a molecular weight of 314.11 g/mol, XLogP of 0.11, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2,3-trifluoro-3-(methoxymethyl)-4-(2-methylpropyl)piperazin-1-yl]methoxyboronic acid is sourced from PubChem (CID 175952229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).