C14H16O10 — CID 175952581
(4S)-3-acetyl-4-[(2S)-2-acetyl-3,4-dihydroxy-5-oxofuran-2-yl]-3,4-dihydroxyhexane-2,5-dione (PubChem CID 175952581) has the molecular formula C14H16O10 and a molecular weight of 344.27 g/mol. Its IUPAC name is (4S)-3-acetyl-4-[(2S)-2-acetyl-3,4-dihydroxy-5-oxofuran-2-yl]-3,4-dihydroxyhexane-2,5-dione.
| Compound Name | (4S)-3-acetyl-4-[(2S)-2-acetyl-3,4-dihydroxy-5-oxofuran-2-yl]-3,4-dihydroxyhexane-2,5-dione |
|---|---|
| PubChem CID | 175952581 |
| Molecular Formula | C14H16O10 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (4S)-3-acetyl-4-[(2S)-2-acetyl-3,4-dihydroxy-5-oxofuran-2-yl]-3,4-dihydroxyhexane-2,5-dione |
| SMILES | CC(=O)C(O)(C(C)=O)[C@@](O)(C(C)=O)[C@@]1(C(C)=O)OC(=O)C(O)=C1O |
| InChI | InChI=1S/C14H16O10/c1-5(15)12(22,6(2)16)14(23,8(4)18)13(7(3)17)10(20)9(19)11(21)24-13/h19-20,22-23H,1-4H3/t13-,14-/m0/s1 |
| InChIKey | DCODSQYDMOTSAZ-KBPBESRZSA-N |
| XLogP | -1.57 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|