About 3-decan-3-yl-2,5-dimethylpyrimidin-4-one
3-decan-3-yl-2,5-dimethylpyrimidin-4-one (PubChem CID 175952994) has the molecular formula C16H28N2O
and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-decan-3-yl-2,5-dimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-decan-3-yl-2,5-dimethylpyrimidin-4-one |
| PubChem CID | 175952994 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-decan-3-yl-2,5-dimethylpyrimidin-4-one |
| SMILES | CCCCCCCC(CC)n1c(C)ncc(C)c1=O |
| InChI | InChI=1S/C16H28N2O/c1-5-7-8-9-10-11-15(6-2)18-14(4)17-12-13(3)16(18)19/h12,15H,5-11H2,1-4H3 |
| InChIKey | UAJQSNDZNVUOJB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decan-3-yl-2,5-dimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decan-3-yl-2,5-dimethylpyrimidin-4-one?
The IUPAC name of 3-decan-3-yl-2,5-dimethylpyrimidin-4-one (CID 175952994) is 3-decan-3-yl-2,5-dimethylpyrimidin-4-one.
What is the SMILES notation for 3-decan-3-yl-2,5-dimethylpyrimidin-4-one?
The canonical SMILES for 3-decan-3-yl-2,5-dimethylpyrimidin-4-one is CCCCCCCC(CC)n1c(C)ncc(C)c1=O.
What is the InChIKey of 3-decan-3-yl-2,5-dimethylpyrimidin-4-one?
The InChIKey is UAJQSNDZNVUOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O/c1-5-7-8-9-10-11-15(6-2)18-14(4)17-12-13(3)16(18)19/h12,15H,5-11H2,1-4H3.
What are the key properties of 3-decan-3-yl-2,5-dimethylpyrimidin-4-one?
3-decan-3-yl-2,5-dimethylpyrimidin-4-one has a molecular weight of 264.41 g/mol, XLogP of 4.17, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decan-3-yl-2,5-dimethylpyrimidin-4-one is sourced from PubChem (CID 175952994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).