C8H4S4 — CID 175953151
3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-thiol (PubChem CID 175953151) has the molecular formula C8H4S4 and a molecular weight of 228.39 g/mol. Its IUPAC name is 3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-thiol.
| Compound Name | 3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-thiol |
|---|---|
| PubChem CID | 175953151 |
| Molecular Formula | C8H4S4 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 227.92 |
| IUPAC Name | 3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-thiol |
| SMILES | Sc1cc2sc3ccsc3c2s1 |
| InChI | InChI=1S/C8H4S4/c9-6-3-5-8(12-6)7-4(11-5)1-2-10-7/h1-3,9H |
| InChIKey | WDYHYPUVNLXVLD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|