C34H35ClN2O4 — CID 175953313
6-(2-chlorophenyl)-5-[4-[(3S)-1-[4-(dimethylamino)-4-oxobut-2-enyl]pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid (PubChem CID 175953313) has the molecular formula C34H35ClN2O4 and a molecular weight of 571.12 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-5-[4-[(3S)-1-[4-(dimethylamino)-4-oxobut-2-enyl]pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid.
| Compound Name | 6-(2-chlorophenyl)-5-[4-[(3S)-1-[4-(dimethylamino)-4-oxobut-2-enyl]pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
|---|---|
| PubChem CID | 175953313 |
| Molecular Formula | C34H35ClN2O4 |
| Molecular Weight | 571.12 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 6-(2-chlorophenyl)-5-[4-[(3S)-1-[4-(dimethylamino)-4-oxobut-2-enyl]pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
| SMILES | CN(C)C(=O)C=CCN1CC[C@H](Oc2ccc(C3=C(c4ccccc4Cl)CCCc4cc(C(=O)O)ccc43)cc2)C1 |
| InChI | InChI=1S/C34H35ClN2O4/c1-36(2)32(38)11-6-19-37-20-18-27(22-37)41-26-15-12-23(13-16-26)33-28-17-14-25(34(39)40)21-24(28)7-5-9-30(33)29-8-3-4-10-31(29)35/h3-4,6,8,10-17,21,27H,5,7,9,18-20,22H2,1-2H3,(H,39,40)/t27-/m0/s1 |
| InChIKey | KFPOWYQLOQNEHU-MHZLTWQESA-N |
| XLogP | 6.43 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.12 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|