C20H20N4OS — CID 175954499
6-(4-ethoxythiophen-2-yl)-N-[2-(1H-indol-6-yl)ethyl]pyrimidin-4-amine (PubChem CID 175954499) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 6-(4-ethoxythiophen-2-yl)-N-[2-(1H-indol-6-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-(4-ethoxythiophen-2-yl)-N-[2-(1H-indol-6-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175954499 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 6-(4-ethoxythiophen-2-yl)-N-[2-(1H-indol-6-yl)ethyl]pyrimidin-4-amine |
| SMILES | CCOc1csc(-c2cc(NCCc3ccc4cc[nH]c4c3)ncn2)c1 |
| InChI | InChI=1S/C20H20N4OS/c1-2-25-16-10-19(26-12-16)18-11-20(24-13-23-18)22-7-5-14-3-4-15-6-8-21-17(15)9-14/h3-4,6,8-13,21H,2,5,7H2,1H3,(H,22,23,24) |
| InChIKey | BDPGNIRASIOGDL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |