About 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid
3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid (PubChem CID 175954593) has the molecular formula C13H11NO5S
and a molecular weight of 293.30 g/mol. Its IUPAC name is 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid |
| PubChem CID | 175954593 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid |
| SMILES | O=C=c1c2ccccc2c(=C=O)n1CCCS(=O)(=O)O |
| InChI | InChI=1S/C13H11NO5S/c15-8-12-10-4-1-2-5-11(10)13(9-16)14(12)6-3-7-20(17,18)19/h1-2,4-5H,3,6-7H2,(H,17,18,19) |
| InChIKey | PSAPHCDNZRBFIF-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid?
The IUPAC name of 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid (CID 175954593) is 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid.
What is the SMILES notation for 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid?
The canonical SMILES for 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid is O=C=c1c2ccccc2c(=C=O)n1CCCS(=O)(=O)O.
What is the InChIKey of 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid?
The InChIKey is PSAPHCDNZRBFIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5S/c15-8-12-10-4-1-2-5-11(10)13(9-16)14(12)6-3-7-20(17,18)19/h1-2,4-5H,3,6-7H2,(H,17,18,19).
What are the key properties of 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid?
3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid has a molecular weight of 293.30 g/mol, XLogP of -1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-bis(oxomethylidene)isoindol-2-yl]propane-1-sulfonic acid is sourced from PubChem (CID 175954593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).