C22H20N4O3 — CID 175954901
3-[3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 175954901) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-[3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 3-[3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 175954901 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-[3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1c(C#N)cccc1-c1nc(N2CCCc3cc(C=O)ccc32)no1 |
| InChI | InChI=1S/C22H20N4O3/c1-14(2)28-20-17(12-23)5-3-7-18(20)21-24-22(25-29-21)26-10-4-6-16-11-15(13-27)8-9-19(16)26/h3,5,7-9,11,13-14H,4,6,10H2,1-2H3 |
| InChIKey | WTNXFNDVIUSGHV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|