About [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene
[fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene (PubChem CID 175955141) has the molecular formula C14H16FO3PS
and a molecular weight of 314.32 g/mol. Its IUPAC name is [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene.
Molecular Properties
| Compound Name | [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene |
| PubChem CID | 175955141 |
| Molecular Formula | C14H16FO3PS |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene |
| SMILES | COP(=O)(F)OC.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C2H6FO3P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3,4)6-2/h1-10H;1-2H3 |
| InChIKey | SRKTYEXTMFGMEX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene?
The IUPAC name of [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene (CID 175955141) is [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene.
What is the SMILES notation for [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene?
The canonical SMILES for [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene is COP(=O)(F)OC.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene?
The InChIKey is SRKTYEXTMFGMEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C2H6FO3P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3,4)6-2/h1-10H;1-2H3.
What are the key properties of [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene?
[fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene has a molecular weight of 314.32 g/mol, XLogP of 5.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [fluoro(methoxy)phosphoryl]oxymethane;phenylsulfanylbenzene is sourced from PubChem (CID 175955141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).