About 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one
8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (PubChem CID 175955149) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
Molecular Properties
| Compound Name | 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
| PubChem CID | 175955149 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
| SMILES | O=C1C2CC2C2COCN12 |
| InChI | InChI=1S/C7H9NO2/c9-7-5-1-4(5)6-2-10-3-8(6)7/h4-6H,1-3H2 |
| InChIKey | VEVPQAJAQGGBSK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
The IUPAC name of 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (CID 175955149) is 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
What is the SMILES notation for 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
The canonical SMILES for 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one is O=C1C2CC2C2COCN12.
What is the InChIKey of 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
The InChIKey is VEVPQAJAQGGBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-7-5-1-4(5)6-2-10-3-8(6)7/h4-6H,1-3H2.
What are the key properties of 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one has a molecular weight of 139.15 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one is sourced from PubChem (CID 175955149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).