About spiro[3H-1-benzofuran-2,2'-pyrrolidine]
spiro[3H-1-benzofuran-2,2'-pyrrolidine] (PubChem CID 175955599) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is spiro[3H-1-benzofuran-2,2'-pyrrolidine].
Molecular Properties
| Compound Name | spiro[3H-1-benzofuran-2,2'-pyrrolidine] |
| PubChem CID | 175955599 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | spiro[3H-1-benzofuran-2,2'-pyrrolidine] |
| SMILES | c1ccc2c(c1)CC1(CCCN1)O2 |
| InChI | InChI=1S/C11H13NO/c1-2-5-10-9(4-1)8-11(13-10)6-3-7-12-11/h1-2,4-5,12H,3,6-8H2 |
| InChIKey | BNBQVHUSZVKIRO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3H-1-benzofuran-2,2'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-1-benzofuran-2,2'-pyrrolidine]?
The IUPAC name of spiro[3H-1-benzofuran-2,2'-pyrrolidine] (CID 175955599) is spiro[3H-1-benzofuran-2,2'-pyrrolidine].
What is the SMILES notation for spiro[3H-1-benzofuran-2,2'-pyrrolidine]?
The canonical SMILES for spiro[3H-1-benzofuran-2,2'-pyrrolidine] is c1ccc2c(c1)CC1(CCCN1)O2.
What is the InChIKey of spiro[3H-1-benzofuran-2,2'-pyrrolidine]?
The InChIKey is BNBQVHUSZVKIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-5-10-9(4-1)8-11(13-10)6-3-7-12-11/h1-2,4-5,12H,3,6-8H2.
What are the key properties of spiro[3H-1-benzofuran-2,2'-pyrrolidine]?
spiro[3H-1-benzofuran-2,2'-pyrrolidine] has a molecular weight of 175.23 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-1-benzofuran-2,2'-pyrrolidine] is sourced from PubChem (CID 175955599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).