C24H43NaO7 — CID 175955663
sodium;2-hydroxypropane-1,2,3-tricarboxylic acid;(Z)-octadec-9-ene (PubChem CID 175955663) has the molecular formula C24H43NaO7 and a molecular weight of 466.59 g/mol. Its IUPAC name is sodium;2-hydroxypropane-1,2,3-tricarboxylic acid;(Z)-octadec-9-ene.
| Compound Name | sodium;2-hydroxypropane-1,2,3-tricarboxylic acid;(Z)-octadec-9-ene |
|---|---|
| PubChem CID | 175955663 |
| Molecular Formula | C24H43NaO7 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | sodium;2-hydroxypropane-1,2,3-tricarboxylic acid;(Z)-octadec-9-ene |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[CH2-]CCCCCCC/C=C\CCCCCCCC.[Na+] |
| InChI | InChI=1S/C18H35.C6H8O7.Na/c1-3-5-7-9-11-13-15-17-18-16-14-12-10-8-6-4-2;7-3(8)1-6(13,5(11)12)2-4(9)10;/h17-18H,1,3-16H2,2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q-1;;+1/b18-17-;; |
| InChIKey | WFWZKIQENZOQPX-NSGFTINJSA-N |
| XLogP | 2.61 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|