About 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate
11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate (PubChem CID 175956194) has the molecular formula C41H82O4
and a molecular weight of 639.10 g/mol. Its IUPAC name is 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate.
Molecular Properties
| Compound Name | 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate |
| PubChem CID | 175956194 |
| Molecular Formula | C41H82O4 |
| Molecular Weight | 639.10 g/mol |
| Exact Mass | 638.62 |
| IUPAC Name | 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate |
| SMILES | CC(C)CCCCCCCCCCOC(=O)CCCCCC(C)C.CC(C)CCCCCCCOC(=O)CCCCCC(C)C |
| InChI | InChI=1S/C22H44O2.C19H38O2/c1-20(2)16-12-9-7-5-6-8-10-15-19-24-22(23)18-14-11-13-17-21(3)4;1-17(2)13-9-6-5-7-12-16-21-19(20)15-11-8-10-14-18(3)4/h20-21H,5-19H2,1-4H3;17-18H,5-16H2,1-4H3 |
| InChIKey | AJOLOEKAWQKGOE-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 639.10 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate?
The IUPAC name of 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate (CID 175956194) is 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate.
What is the SMILES notation for 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate?
The canonical SMILES for 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate is CC(C)CCCCCCCCCCOC(=O)CCCCCC(C)C.CC(C)CCCCCCCOC(=O)CCCCCC(C)C.
What is the InChIKey of 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate?
The InChIKey is AJOLOEKAWQKGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.C19H38O2/c1-20(2)16-12-9-7-5-6-8-10-15-19-24-22(23)18-14-11-13-17-21(3)4;1-17(2)13-9-6-5-7-12-16-21-19(20)15-11-8-10-14-18(3)4/h20-21H,5-19H2,1-4H3;17-18H,5-16H2,1-4H3.
What are the key properties of 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate?
11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate has a molecular weight of 639.10 g/mol, XLogP of 13.44, 31 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyldodecyl 7-methyloctanoate;8-methylnonyl 7-methyloctanoate is sourced from PubChem (CID 175956194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).