C9H8ClN3O2 — CID 175956756
7-chloro-1,6-dimethyl-4H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 175956756) has the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. Its IUPAC name is 7-chloro-1,6-dimethyl-4H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-chloro-1,6-dimethyl-4H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 175956756 |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 7-chloro-1,6-dimethyl-4H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cc1nc2[nH]c(=O)c(=O)n(C)c2cc1Cl |
| InChI | InChI=1S/C9H8ClN3O2/c1-4-5(10)3-6-7(11-4)12-8(14)9(15)13(6)2/h3H,1-2H3,(H,11,12,14) |
| InChIKey | DJKHRHQUVADIJH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|