C19H18N6O2 — CID 175956763
6-[4-(1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 175956763) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 6-[4-(1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 175956763 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 6-[4-(1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(c3ccc(C#N)cn3)CC2)c2ncccc21 |
| InChI | InChI=1S/C19H18N6O2/c1-23-15-3-2-8-21-17(15)25(19(27)18(23)26)14-6-9-24(10-7-14)16-5-4-13(11-20)12-22-16/h2-5,8,12,14H,6-7,9-10H2,1H3 |
| InChIKey | USEZYFNSYFWZDB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|