About 5-pyrrol-1-yl-1,3-benzoxazol-2-amine
5-pyrrol-1-yl-1,3-benzoxazol-2-amine (PubChem CID 175957420) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-pyrrol-1-yl-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-pyrrol-1-yl-1,3-benzoxazol-2-amine |
| PubChem CID | 175957420 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 5-pyrrol-1-yl-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(-n3cccc3)ccc2o1 |
| InChI | InChI=1S/C11H9N3O/c12-11-13-9-7-8(3-4-10(9)15-11)14-5-1-2-6-14/h1-7H,(H2,12,13) |
| InChIKey | FVDXQWBJJUMLOT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyrrol-1-yl-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrol-1-yl-1,3-benzoxazol-2-amine?
The IUPAC name of 5-pyrrol-1-yl-1,3-benzoxazol-2-amine (CID 175957420) is 5-pyrrol-1-yl-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-pyrrol-1-yl-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-pyrrol-1-yl-1,3-benzoxazol-2-amine is Nc1nc2cc(-n3cccc3)ccc2o1.
What is the InChIKey of 5-pyrrol-1-yl-1,3-benzoxazol-2-amine?
The InChIKey is FVDXQWBJJUMLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O/c12-11-13-9-7-8(3-4-10(9)15-11)14-5-1-2-6-14/h1-7H,(H2,12,13).
What are the key properties of 5-pyrrol-1-yl-1,3-benzoxazol-2-amine?
5-pyrrol-1-yl-1,3-benzoxazol-2-amine has a molecular weight of 199.21 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrol-1-yl-1,3-benzoxazol-2-amine is sourced from PubChem (CID 175957420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).