C8H7F2N3O — CID 175957961
2-(2,2-difluoroethoxy)imidazo[1,2-a]pyrazine (PubChem CID 175957961) has the molecular formula C8H7F2N3O and a molecular weight of 199.16 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)imidazo[1,2-a]pyrazine.
| Compound Name | 2-(2,2-difluoroethoxy)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 175957961 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-(2,2-difluoroethoxy)imidazo[1,2-a]pyrazine |
| SMILES | FC(F)COc1cn2ccncc2n1 |
| InChI | InChI=1S/C8H7F2N3O/c9-6(10)5-14-8-4-13-2-1-11-3-7(13)12-8/h1-4,6H,5H2 |
| InChIKey | OWOKJUHZVZPFPX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |