About 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine
8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine (PubChem CID 175958236) has the molecular formula C12H7F3N4S
and a molecular weight of 296.28 g/mol. Its IUPAC name is 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine |
| PubChem CID | 175958236 |
| Molecular Formula | C12H7F3N4S |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine |
| SMILES | Nc1ncnc2c(-c3cnc(C(F)(F)F)s3)cccc12 |
| InChI | InChI=1S/C12H7F3N4S/c13-12(14,15)11-17-4-8(20-11)6-2-1-3-7-9(6)18-5-19-10(7)16/h1-5H,(H2,16,18,19) |
| InChIKey | ZWSGBRISHPQLMK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine?
The IUPAC name of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine (CID 175958236) is 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine.
What is the SMILES notation for 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine?
The canonical SMILES for 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine is Nc1ncnc2c(-c3cnc(C(F)(F)F)s3)cccc12.
What is the InChIKey of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine?
The InChIKey is ZWSGBRISHPQLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F3N4S/c13-12(14,15)11-17-4-8(20-11)6-2-1-3-7-9(6)18-5-19-10(7)16/h1-5H,(H2,16,18,19).
What are the key properties of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine?
8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine has a molecular weight of 296.28 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]quinazolin-4-amine is sourced from PubChem (CID 175958236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).