C14H20N4O4 — CID 175959015
N-[4-(ethylamino)pyrimidin-2-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboxamide (PubChem CID 175959015) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[4-(ethylamino)pyrimidin-2-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboxamide.
| Compound Name | N-[4-(ethylamino)pyrimidin-2-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboxamide |
|---|---|
| PubChem CID | 175959015 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[4-(ethylamino)pyrimidin-2-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboxamide |
| SMILES | CCNc1ccnc(NC(=O)C2OCC3OC(C)(C)OC32)n1 |
| InChI | InChI=1S/C14H20N4O4/c1-4-15-9-5-6-16-13(17-9)18-12(19)11-10-8(7-20-11)21-14(2,3)22-10/h5-6,8,10-11H,4,7H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | AYGWGAMYMPYRKC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |