C10H16N4 — CID 175959752
1,3-dimethylcyclohexa-3,5-diene-1,2-dicarboximidamide (PubChem CID 175959752) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 1,3-dimethylcyclohexa-3,5-diene-1,2-dicarboximidamide.
| Compound Name | 1,3-dimethylcyclohexa-3,5-diene-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 175959752 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1,3-dimethylcyclohexa-3,5-diene-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)C1C(C)=CC=CC1(C)/C(N)=N/[H] |
| InChI | InChI=1S/C10H16N4/c1-6-4-3-5-10(2,9(13)14)7(6)8(11)12/h3-5,7H,1-2H3,(H3,11,12)(H3,13,14) |
| InChIKey | VVRQAFGTLATIPZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|