C26H26N4O4S — CID 175960381
N-[2-(4-cyano-1,3-thiazolidin-3-yl)-2-oxoethyl]-6-[4-(3-methoxypropoxy)phenyl]quinoline-4-carboxamide (PubChem CID 175960381) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[2-(4-cyano-1,3-thiazolidin-3-yl)-2-oxoethyl]-6-[4-(3-methoxypropoxy)phenyl]quinoline-4-carboxamide.
| Compound Name | N-[2-(4-cyano-1,3-thiazolidin-3-yl)-2-oxoethyl]-6-[4-(3-methoxypropoxy)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 175960381 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[2-(4-cyano-1,3-thiazolidin-3-yl)-2-oxoethyl]-6-[4-(3-methoxypropoxy)phenyl]quinoline-4-carboxamide |
| SMILES | COCCCOc1ccc(-c2ccc3nccc(C(=O)NCC(=O)N4CSCC4C#N)c3c2)cc1 |
| InChI | InChI=1S/C26H26N4O4S/c1-33-11-2-12-34-21-6-3-18(4-7-21)19-5-8-24-23(13-19)22(9-10-28-24)26(32)29-15-25(31)30-17-35-16-20(30)14-27/h3-10,13,20H,2,11-12,15-17H2,1H3,(H,29,32) |
| InChIKey | SHMNBFYXVLCQJE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|