C41H76ClNO — CID 175960850
2-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]ethanol;hydrochloride (PubChem CID 175960850) has the molecular formula C41H76ClNO and a molecular weight of 634.52 g/mol. Its IUPAC name is 2-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]ethanol;hydrochloride.
| Compound Name | 2-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 175960850 |
| Molecular Formula | C41H76ClNO |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 633.56 |
| IUPAC Name | 2-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]ethanol;hydrochloride |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)CN(CCO)C1.Cl |
| InChI | InChI=1S/C41H75NO.ClH/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(39-42(40-41)37-38-43)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h11-14,17-20,43H,3-10,15-16,21-40H2,1-2H3;1H/b13-11-,14-12-,19-17-,20-18-; |
| InChIKey | HHMMQSHMXKKLBY-RSTCGTDESA-N |
| XLogP | 13.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|