About 8-cyclopropyl-5,6-difluoronaphthalen-1-ol
8-cyclopropyl-5,6-difluoronaphthalen-1-ol (PubChem CID 175961016) has the molecular formula C13H10F2O
and a molecular weight of 220.22 g/mol. Its IUPAC name is 8-cyclopropyl-5,6-difluoronaphthalen-1-ol.
Molecular Properties
| Compound Name | 8-cyclopropyl-5,6-difluoronaphthalen-1-ol |
| PubChem CID | 175961016 |
| Molecular Formula | C13H10F2O |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 8-cyclopropyl-5,6-difluoronaphthalen-1-ol |
| SMILES | Oc1cccc2c(F)c(F)cc(C3CC3)c12 |
| InChI | InChI=1S/C13H10F2O/c14-10-6-9(7-4-5-7)12-8(13(10)15)2-1-3-11(12)16/h1-3,6-7,16H,4-5H2 |
| InChIKey | BXYAVNOVORZOJL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-cyclopropyl-5,6-difluoronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopropyl-5,6-difluoronaphthalen-1-ol?
The IUPAC name of 8-cyclopropyl-5,6-difluoronaphthalen-1-ol (CID 175961016) is 8-cyclopropyl-5,6-difluoronaphthalen-1-ol.
What is the SMILES notation for 8-cyclopropyl-5,6-difluoronaphthalen-1-ol?
The canonical SMILES for 8-cyclopropyl-5,6-difluoronaphthalen-1-ol is Oc1cccc2c(F)c(F)cc(C3CC3)c12.
What is the InChIKey of 8-cyclopropyl-5,6-difluoronaphthalen-1-ol?
The InChIKey is BXYAVNOVORZOJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2O/c14-10-6-9(7-4-5-7)12-8(13(10)15)2-1-3-11(12)16/h1-3,6-7,16H,4-5H2.
What are the key properties of 8-cyclopropyl-5,6-difluoronaphthalen-1-ol?
8-cyclopropyl-5,6-difluoronaphthalen-1-ol has a molecular weight of 220.22 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopropyl-5,6-difluoronaphthalen-1-ol is sourced from PubChem (CID 175961016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).