C16H24F2N3OPSi2 — CID 175961127
[[[(difluoroamino)-[[dimethyl(phenyl)silyl]amino]phosphoryl]amino]-dimethylsilyl]benzene (PubChem CID 175961127) has the molecular formula C16H24F2N3OPSi2 and a molecular weight of 399.53 g/mol. Its IUPAC name is [[[(difluoroamino)-[[dimethyl(phenyl)silyl]amino]phosphoryl]amino]-dimethylsilyl]benzene.
| Compound Name | [[[(difluoroamino)-[[dimethyl(phenyl)silyl]amino]phosphoryl]amino]-dimethylsilyl]benzene |
|---|---|
| PubChem CID | 175961127 |
| Molecular Formula | C16H24F2N3OPSi2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [[[(difluoroamino)-[[dimethyl(phenyl)silyl]amino]phosphoryl]amino]-dimethylsilyl]benzene |
| SMILES | C[Si](C)(NP(=O)(N[Si](C)(C)c1ccccc1)N(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H24F2N3OPSi2/c1-24(2,15-11-7-5-8-12-15)19-23(22,21(17)18)20-25(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3,(H2,19,20,22) |
| InChIKey | RURNGUROTZBOBA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|