C18H16BrF3N4O — CID 175961562
6-bromo-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-8-ethoxypyrido[3,4-d]pyrimidin-4-amine (PubChem CID 175961562) has the molecular formula C18H16BrF3N4O and a molecular weight of 441.25 g/mol. Its IUPAC name is 6-bromo-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-8-ethoxypyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-bromo-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-8-ethoxypyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175961562 |
| Molecular Formula | C18H16BrF3N4O |
| Molecular Weight | 441.25 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 6-bromo-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-8-ethoxypyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CCOc1nc(Br)cc2c(N[C@H](C)c3cccc(C(F)F)c3F)ncnc12 |
| InChI | InChI=1S/C18H16BrF3N4O/c1-3-27-18-15-12(7-13(19)26-18)17(24-8-23-15)25-9(2)10-5-4-6-11(14(10)20)16(21)22/h4-9,16H,3H2,1-2H3,(H,23,24,25)/t9-/m1/s1 |
| InChIKey | LVVLGAPOEDOHEZ-SECBINFHSA-N |
| XLogP | 5.44 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.25 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|