C13H22BNO4 — CID 175961804
2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrrolidine-1-carboxylic acid (PubChem CID 175961804) has the molecular formula C13H22BNO4 and a molecular weight of 267.13 g/mol. Its IUPAC name is 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175961804 |
| Molecular Formula | C13H22BNO4 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)OB(C=CC2CCCN2C(=O)O)OC1(C)C |
| InChI | InChI=1S/C13H22BNO4/c1-12(2)13(3,4)19-14(18-12)8-7-10-6-5-9-15(10)11(16)17/h7-8,10H,5-6,9H2,1-4H3,(H,16,17) |
| InChIKey | PDBFBXKOUUPAIT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|