C11H14N2O5 — CID 175962691
(2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 175962691) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 175962691 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C11H14N2O5/c1-6(2)10(11(17)18)12-7(14)5-13-8(15)3-4-9(13)16/h3-4,6,10H,5H2,1-2H3,(H,12,14)(H,17,18)/t10-/m0/s1 |
| InChIKey | LZMLNFHTJOCNPW-JTQLQIEISA-N |
| XLogP | -0.86 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|