C18H16FN5O2 — CID 175962958
1-[(2-fluorophenyl)methyl]-3-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]urea (PubChem CID 175962958) has the molecular formula C18H16FN5O2 and a molecular weight of 353.36 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]urea.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 175962958 |
| Molecular Formula | C18H16FN5O2 |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]urea |
| SMILES | COc1ncc(-c2ccc(NC(=O)NCc3ccccc3F)nc2)cn1 |
| InChI | InChI=1S/C18H16FN5O2/c1-26-18-22-10-14(11-23-18)12-6-7-16(20-8-12)24-17(25)21-9-13-4-2-3-5-15(13)19/h2-8,10-11H,9H2,1H3,(H2,20,21,24,25) |
| InChIKey | XXGHITNIZMZJBX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |