C18H26F3N3O2 — CID 175963003
2-tert-butyl-6-[2-[[4-(trifluoromethyl)cyclohexyl]methyl]hydrazinyl]pyridine-3-carboxylic acid (PubChem CID 175963003) has the molecular formula C18H26F3N3O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-tert-butyl-6-[2-[[4-(trifluoromethyl)cyclohexyl]methyl]hydrazinyl]pyridine-3-carboxylic acid.
| Compound Name | 2-tert-butyl-6-[2-[[4-(trifluoromethyl)cyclohexyl]methyl]hydrazinyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175963003 |
| Molecular Formula | C18H26F3N3O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-tert-butyl-6-[2-[[4-(trifluoromethyl)cyclohexyl]methyl]hydrazinyl]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)c1nc(NNCC2CCC(C(F)(F)F)CC2)ccc1C(=O)O |
| InChI | InChI=1S/C18H26F3N3O2/c1-17(2,3)15-13(16(25)26)8-9-14(23-15)24-22-10-11-4-6-12(7-5-11)18(19,20)21/h8-9,11-12,22H,4-7,10H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | LDVBKIQCESKDSV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|