About [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate
[4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate (PubChem CID 175963007) has the molecular formula C28H34FN3O5
and a molecular weight of 511.59 g/mol. Its IUPAC name is [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate.
Molecular Properties
| Compound Name | [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate |
| PubChem CID | 175963007 |
| Molecular Formula | C28H34FN3O5 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate |
| SMILES | O=C(OCn1cc(F)c(=O)[nH]c1=O)Oc1ccc(C2CCN(CC34CC5CC(CC(C5)C3)C4)CC2)cc1 |
| InChI | InChI=1S/C28H34FN3O5/c29-24-15-32(26(34)30-25(24)33)17-36-27(35)37-23-3-1-21(2-4-23)22-5-7-31(8-6-22)16-28-12-18-9-19(13-28)11-20(10-18)14-28/h1-4,15,18-20,22H,5-14,16-17H2,(H,30,33,34) |
| InChIKey | ARCKVRAXMOCCRP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate?
The IUPAC name of [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate (CID 175963007) is [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate.
What is the SMILES notation for [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate?
The canonical SMILES for [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate is O=C(OCn1cc(F)c(=O)[nH]c1=O)Oc1ccc(C2CCN(CC34CC5CC(CC(C5)C3)C4)CC2)cc1.
What is the InChIKey of [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate?
The InChIKey is ARCKVRAXMOCCRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34FN3O5/c29-24-15-32(26(34)30-25(24)33)17-36-27(35)37-23-3-1-21(2-4-23)22-5-7-31(8-6-22)16-28-12-18-9-19(13-28)11-20(10-18)14-28/h1-4,15,18-20,22H,5-14,16-17H2,(H,30,33,34).
What are the key properties of [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate?
[4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate has a molecular weight of 511.59 g/mol, XLogP of 4.24, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(1-adamantylmethyl)piperidin-4-yl]phenyl] (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl carbonate is sourced from PubChem (CID 175963007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).