C10H11N3O — CID 175963273
(10S)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5,11-tetraene (PubChem CID 175963273) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is (10S)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5,11-tetraene.
| Compound Name | (10S)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5,11-tetraene |
|---|---|
| PubChem CID | 175963273 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (10S)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5,11-tetraene |
| SMILES | C1=NCCN2c3cccnc3OC[C@H]12 |
| InChI | InChI=1S/C10H11N3O/c1-2-9-10(12-3-1)14-7-8-6-11-4-5-13(8)9/h1-3,6,8H,4-5,7H2/t8-/m0/s1 |
| InChIKey | PQUVXVOCYPVZLX-QMMMGPOBSA-N |
| XLogP | 0.73 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |