C25H26N2O2 — CID 175964446
3-[[4-(3-amino-5-methylphenoxy)-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]oxy]-5-methylaniline (PubChem CID 175964446) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[[4-(3-amino-5-methylphenoxy)-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]oxy]-5-methylaniline.
| Compound Name | 3-[[4-(3-amino-5-methylphenoxy)-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]oxy]-5-methylaniline |
|---|---|
| PubChem CID | 175964446 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[[4-(3-amino-5-methylphenoxy)-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]oxy]-5-methylaniline |
| SMILES | Cc1cc(N)cc(Oc2ccc3c(c2)C2CCC3C2Oc2cc(C)cc(N)c2)c1 |
| InChI | InChI=1S/C25H26N2O2/c1-14-7-16(26)11-19(9-14)28-18-3-4-21-22-5-6-23(24(21)13-18)25(22)29-20-10-15(2)8-17(27)12-20/h3-4,7-13,22-23,25H,5-6,26-27H2,1-2H3 |
| InChIKey | OQPUATDOVFGASJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|