C8H9N3O2 — CID 175964495
1,3-dimethyl-7H-pyrazolo[5,4-b]pyridine-4,6-dione (PubChem CID 175964495) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 1,3-dimethyl-7H-pyrazolo[5,4-b]pyridine-4,6-dione.
| Compound Name | 1,3-dimethyl-7H-pyrazolo[5,4-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 175964495 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 1,3-dimethyl-7H-pyrazolo[5,4-b]pyridine-4,6-dione |
| SMILES | Cc1nn(C)c2c1C(=O)CC(=O)N2 |
| InChI | InChI=1S/C8H9N3O2/c1-4-7-5(12)3-6(13)9-8(7)11(2)10-4/h3H2,1-2H3,(H,9,13) |
| InChIKey | WPAUFGRVEJVFOY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|