About 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine
6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine (PubChem CID 175964551) has the molecular formula C9H10ClN3O
and a molecular weight of 211.65 g/mol. Its IUPAC name is 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine |
| PubChem CID | 175964551 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine |
| SMILES | COc1cc(Cl)nc2c1c(C)nn2C |
| InChI | InChI=1S/C9H10ClN3O/c1-5-8-6(14-3)4-7(10)11-9(8)13(2)12-5/h4H,1-3H3 |
| InChIKey | SBMYDMCEMMRUKT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine?
The IUPAC name of 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine (CID 175964551) is 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine.
What is the SMILES notation for 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine?
The canonical SMILES for 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine is COc1cc(Cl)nc2c1c(C)nn2C.
What is the InChIKey of 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine?
The InChIKey is SBMYDMCEMMRUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3O/c1-5-8-6(14-3)4-7(10)11-9(8)13(2)12-5/h4H,1-3H3.
What are the key properties of 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine?
6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine has a molecular weight of 211.65 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-methoxy-1,3-dimethylpyrazolo[5,4-b]pyridine is sourced from PubChem (CID 175964551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).