About tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate
tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate (PubChem CID 175965074) has the molecular formula C28H54N2O6
and a molecular weight of 514.75 g/mol. Its IUPAC name is tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate |
| PubChem CID | 175965074 |
| Molecular Formula | C28H54N2O6 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate |
| SMILES | CC(O)CCC1CCN(C(=O)OC(C)(C)C)CC1.C[C@H](O)CCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/2C14H27NO3/c2*1-11(16)5-6-12-7-9-15(10-8-12)13(17)18-14(2,3)4/h2*11-12,16H,5-10H2,1-4H3/t11-;/m0./s1 |
| InChIKey | UFLNLOKUEWAVNV-MERQFXBCSA-N |
| XLogP | 5.59 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate (CID 175965074) is tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate is CC(O)CCC1CCN(C(=O)OC(C)(C)C)CC1.C[C@H](O)CCC1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate?
The InChIKey is UFLNLOKUEWAVNV-MERQFXBCSA-N. The full InChI is InChI=1S/2C14H27NO3/c2*1-11(16)5-6-12-7-9-15(10-8-12)13(17)18-14(2,3)4/h2*11-12,16H,5-10H2,1-4H3/t11-;/m0./s1.
What are the key properties of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate?
tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate has a molecular weight of 514.75 g/mol, XLogP of 5.59, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;tert-butyl 4-[(3S)-3-hydroxybutyl]piperidine-1-carboxylate is sourced from PubChem (CID 175965074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).