C20H24N4O4 — CID 175965728
3-[[2-[(3,5-dimethoxyphenyl)methyl]-5-propan-2-yl-1H-imidazol-4-yl]methylidene]piperazine-2,5-dione (PubChem CID 175965728) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[[2-[(3,5-dimethoxyphenyl)methyl]-5-propan-2-yl-1H-imidazol-4-yl]methylidene]piperazine-2,5-dione.
| Compound Name | 3-[[2-[(3,5-dimethoxyphenyl)methyl]-5-propan-2-yl-1H-imidazol-4-yl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 175965728 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[[2-[(3,5-dimethoxyphenyl)methyl]-5-propan-2-yl-1H-imidazol-4-yl]methylidene]piperazine-2,5-dione |
| SMILES | COc1cc(Cc2nc(C=C3NC(=O)CNC3=O)c(C(C)C)[nH]2)cc(OC)c1 |
| InChI | InChI=1S/C20H24N4O4/c1-11(2)19-15(9-16-20(26)21-10-18(25)23-16)22-17(24-19)7-12-5-13(27-3)8-14(6-12)28-4/h5-6,8-9,11H,7,10H2,1-4H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | UQIVAGOZLHUXEP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|