C24H34N2O6 — CID 175966609
4-[2-[4-[[(1R,5S)-7-oxo-9-oxa-2,6-diazaspiro[4.5]decan-1-yl]methoxy]cyclohexyl]phenoxy]butanoic acid (PubChem CID 175966609) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is 4-[2-[4-[[(1R,5S)-7-oxo-9-oxa-2,6-diazaspiro[4.5]decan-1-yl]methoxy]cyclohexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-[4-[[(1R,5S)-7-oxo-9-oxa-2,6-diazaspiro[4.5]decan-1-yl]methoxy]cyclohexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 175966609 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 4-[2-[4-[[(1R,5S)-7-oxo-9-oxa-2,6-diazaspiro[4.5]decan-1-yl]methoxy]cyclohexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccccc1C1CCC(OC[C@@H]2NCC[C@@]23COCC(=O)N3)CC1 |
| InChI | InChI=1S/C24H34N2O6/c27-22-15-30-16-24(26-22)11-12-25-21(24)14-32-18-9-7-17(8-10-18)19-4-1-2-5-20(19)31-13-3-6-23(28)29/h1-2,4-5,17-18,21,25H,3,6-16H2,(H,26,27)(H,28,29)/t17?,18?,21-,24+/m0/s1 |
| InChIKey | IGBSZRUDOSOAGS-QBEJEKAMSA-N |
| XLogP | 2.22 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|